C15H18BrClN2O4 — CID 9081222
[2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate (PubChem CID 9081222) has the molecular formula C15H18BrClN2O4 and a molecular weight of 405.68 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 9081222 |
| Molecular Formula | C15H18BrClN2O4 |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)COC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C15H18BrClN2O4/c1-3-6-18-14(21)9(2)19-13(20)8-23-15(22)11-7-10(16)4-5-12(11)17/h4-5,7,9H,3,6,8H2,1-2H3,(H,18,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | DYJOCHQBIZPAOL-VIFPVBQESA-N |
| XLogP | 2.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |