C19H19BrClNO3 — CID 2091272
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate (PubChem CID 2091272) has the molecular formula C19H19BrClNO3 and a molecular weight of 424.72 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 2091272 |
| Molecular Formula | C19H19BrClNO3 |
| Molecular Weight | 424.72 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] 5-bromo-2-chlorobenzoate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COC(=O)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C19H19BrClNO3/c1-13(7-8-14-5-3-2-4-6-14)22-18(23)12-25-19(24)16-11-15(20)9-10-17(16)21/h2-6,9-11,13H,7-8,12H2,1H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | GVJNAPAKAAWCCF-CYBMUJFWSA-N |
| XLogP | 4.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |