C26H24ClNO4 — CID 4626507
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-(4-chlorobenzoyl)benzoate (PubChem CID 4626507) has the molecular formula C26H24ClNO4 and a molecular weight of 449.93 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-(4-chlorobenzoyl)benzoate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 4626507 |
| Molecular Formula | C26H24ClNO4 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-(4-chlorobenzoyl)benzoate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H24ClNO4/c1-18(11-12-19-7-3-2-4-8-19)28-24(29)17-32-26(31)23-10-6-5-9-22(23)25(30)20-13-15-21(27)16-14-20/h2-10,13-16,18H,11-12,17H2,1H3,(H,28,29) |
| InChIKey | YTRWOLSIJYABRD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |