C17H14BrClN2O4 — CID 2092965
[2-(benzylcarbamoylamino)-2-oxoethyl] 5-bromo-2-chlorobenzoate (PubChem CID 2092965) has the molecular formula C17H14BrClN2O4 and a molecular weight of 425.67 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 5-bromo-2-chlorobenzoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-bromo-2-chlorobenzoate |
|---|---|
| PubChem CID | 2092965 |
| Molecular Formula | C17H14BrClN2O4 |
| Molecular Weight | 425.67 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 5-bromo-2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1Cl)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H14BrClN2O4/c18-12-6-7-14(19)13(8-12)16(23)25-10-15(22)21-17(24)20-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,20,21,22,24) |
| InChIKey | WVFISTWKZPFGJU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |