C17H15IN2O4 — CID 2509496
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate (PubChem CID 2509496) has the molecular formula C17H15IN2O4 and a molecular weight of 438.22 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2509496 |
| Molecular Formula | C17H15IN2O4 |
| Molecular Weight | 438.22 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-iodobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1I)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H15IN2O4/c18-14-9-5-4-8-13(14)16(22)24-11-15(21)20-17(23)19-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,19,20,21,23) |
| InChIKey | WKIZYZHKFWAOEN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|