C18H16N6O4 — CID 7399330
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate (PubChem CID 7399330) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7399330 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1-n1cnnn1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H16N6O4/c25-16(21-18(27)19-10-13-6-2-1-3-7-13)11-28-17(26)14-8-4-5-9-15(14)24-12-20-22-23-24/h1-9,12H,10-11H2,(H2,19,21,25,27) |
| InChIKey | KKXMJHQYKAKCGH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |