C21H21N5O4 — CID 7399528
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate (PubChem CID 7399528) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 7399528 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(tetrazol-1-yl)benzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=O)COC(=O)c2ccccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C21H21N5O4/c1-21(2,3)15-10-8-14(9-11-15)19(28)23-18(27)12-30-20(29)16-6-4-5-7-17(16)26-13-22-24-25-26/h4-11,13H,12H2,1-3H3,(H,23,27,28) |
| InChIKey | AKTGJKQKVOVDFO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |