C24H23NO5 — CID 7891483
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 7891483) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7891483 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=O)COC(=O)c2cc3ccccc3cc2O)cc1 |
| InChI | InChI=1S/C24H23NO5/c1-24(2,3)18-10-8-15(9-11-18)22(28)25-21(27)14-30-23(29)19-12-16-6-4-5-7-17(16)13-20(19)26/h4-13,26H,14H2,1-3H3,(H,25,27,28) |
| InChIKey | WZESFWRFDXAFDR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |