C19H27NO4 — CID 7950882
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3,3-dimethylbutanoate (PubChem CID 7950882) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3,3-dimethylbutanoate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 7950882 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OCC(=O)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-18(2,3)11-16(22)24-12-15(21)20-17(23)13-7-9-14(10-8-13)19(4,5)6/h7-10H,11-12H2,1-6H3,(H,20,21,23) |
| InChIKey | ISYIMVCMXDITTD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |