C18H23NO4 — CID 8760032
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 8760032) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8760032 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H23NO4/c1-12(2)10-16(21)23-11-15(20)19-17(22)13-6-8-14(9-7-13)18(3,4)5/h6-10H,11H2,1-5H3,(H,19,20,22) |
| InChIKey | FTMAQUZICXEGKA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|