C21H23NO5 — CID 7891349
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-methoxybenzoate (PubChem CID 7891349) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-methoxybenzoate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 7891349 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)OCC(=O)NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-21(2,3)15-11-9-14(10-12-15)19(24)22-18(23)13-27-20(25)16-7-5-6-8-17(16)26-4/h5-12H,13H2,1-4H3,(H,22,23,24) |
| InChIKey | WOWUAWNXQUOYTG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |