C20H19Cl2NO4 — CID 7722764
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2,3-dichlorobenzoate (PubChem CID 7722764) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 7722764 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2,3-dichlorobenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=O)COC(=O)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H19Cl2NO4/c1-20(2,3)13-9-7-12(8-10-13)18(25)23-16(24)11-27-19(26)14-5-4-6-15(21)17(14)22/h4-10H,11H2,1-3H3,(H,23,24,25) |
| InChIKey | SWHCNYCPBDRQOY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |