C11H8Cl2F3NO3 — CID 2446620
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,3-dichlorobenzoate (PubChem CID 2446620) has the molecular formula C11H8Cl2F3NO3 and a molecular weight of 330.09 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2446620 |
| Molecular Formula | C11H8Cl2F3NO3 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 2,3-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1Cl)NCC(F)(F)F |
| InChI | InChI=1S/C11H8Cl2F3NO3/c12-7-3-1-2-6(9(7)13)10(19)20-4-8(18)17-5-11(14,15)16/h1-3H,4-5H2,(H,17,18) |
| InChIKey | LDYKPEYVHQXNQY-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |