C14H17Cl2NO3 — CID 2645595
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2,3-dichlorobenzoate (PubChem CID 2645595) has the molecular formula C14H17Cl2NO3 and a molecular weight of 318.20 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2645595 |
| Molecular Formula | C14H17Cl2NO3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 2,3-dichlorobenzoate |
| SMILES | CC(C)[C@@H](C)NC(=O)COC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H17Cl2NO3/c1-8(2)9(3)17-12(18)7-20-14(19)10-5-4-6-11(15)13(10)16/h4-6,8-9H,7H2,1-3H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | PKUYBTQNYHGERJ-SECBINFHSA-N |
| XLogP | 3.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |