C15H18Cl2N2O4 — CID 2487293
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2,3-dichlorobenzoate (PubChem CID 2487293) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2487293 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2,3-dichlorobenzoate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-9(2)6-7-18-15(22)19-12(20)8-23-14(21)10-4-3-5-11(16)13(10)17/h3-5,9H,6-8H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | XDEHALLJPUWTRM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |