C16H21ClN2O5 — CID 2614821
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate (PubChem CID 2614821) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2614821 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)OCC(=O)NC(=O)NCCC(C)C |
| InChI | InChI=1S/C16H21ClN2O5/c1-10(2)6-7-18-16(22)19-14(20)9-24-15(21)12-8-11(17)4-5-13(12)23-3/h4-5,8,10H,6-7,9H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | SVIOICGOODVBAS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |