C16H22N2O5 — CID 2611623
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate (PubChem CID 2611623) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 2611623 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(=O)NCCC(C)C)c(O)c1 |
| InChI | InChI=1S/C16H22N2O5/c1-10(2)6-7-17-16(22)18-14(20)9-23-15(21)12-5-4-11(3)8-13(12)19/h4-5,8,10,19H,6-7,9H2,1-3H3,(H2,17,18,20,22) |
| InChIKey | DIFSRCZHSZJTSV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |