C14H16N2O5 — CID 7567304
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate (PubChem CID 7567304) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
|---|---|
| PubChem CID | 7567304 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 2-hydroxy-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(=O)NC2CC2)c(O)c1 |
| InChI | InChI=1S/C14H16N2O5/c1-8-2-5-10(11(17)6-8)13(19)21-7-12(18)16-14(20)15-9-3-4-9/h2,5-6,9,17H,3-4,7H2,1H3,(H2,15,16,18,20) |
| InChIKey | OHDDYXIBHRFOPF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |