C15H18N2O4 — CID 8708768
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 3,4-dimethylbenzoate (PubChem CID 8708768) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 3,4-dimethylbenzoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 8708768 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC(=O)NC2CC2)cc1C |
| InChI | InChI=1S/C15H18N2O4/c1-9-3-4-11(7-10(9)2)14(19)21-8-13(18)17-15(20)16-12-5-6-12/h3-4,7,12H,5-6,8H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | KOXICJPZQGMVHP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |