C20H25N3O4 — CID 9111860
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 9111860) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 9111860 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OCC(=O)NC(=O)NC3CCCCC3)cc2c1C |
| InChI | InChI=1S/C20H25N3O4/c1-12-13(2)21-17-9-8-14(10-16(12)17)19(25)27-11-18(24)23-20(26)22-15-6-4-3-5-7-15/h8-10,15,21H,3-7,11H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | YTGSROKCVSMDQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|