C17H22N2O6S — CID 8836797
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 8836797) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 8836797 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | CS(=O)(=O)Cc1cccc(C(=O)OCC(=O)NC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H22N2O6S/c1-26(23,24)11-12-5-4-6-13(9-12)16(21)25-10-15(20)19-17(22)18-14-7-2-3-8-14/h4-6,9,14H,2-3,7-8,10-11H2,1H3,(H2,18,19,20,22) |
| InChIKey | OQMJCPVICUEQSQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |