C19H26N2O6S — CID 46825669
[2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate (PubChem CID 46825669) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate.
| Compound Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 46825669 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] 3-(methylsulfonylmethyl)benzoate |
| SMILES | CC1CCCCC1NC(=O)NC(=O)COC(=O)c1cccc(CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H26N2O6S/c1-13-6-3-4-9-16(13)20-19(24)21-17(22)11-27-18(23)15-8-5-7-14(10-15)12-28(2,25)26/h5,7-8,10,13,16H,3-4,6,9,11-12H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | QMGNBZJHISVCLH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |