C19H22N4O4 — CID 55309165
[2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] quinoxaline-6-carboxylate (PubChem CID 55309165) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] quinoxaline-6-carboxylate.
| Compound Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 55309165 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-[(2-methylcyclohexyl)carbamoylamino]-2-oxoethyl] quinoxaline-6-carboxylate |
| SMILES | CC1CCCCC1NC(=O)NC(=O)COC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C19H22N4O4/c1-12-4-2-3-5-14(12)22-19(26)23-17(24)11-27-18(25)13-6-7-15-16(10-13)21-9-8-20-15/h6-10,12,14H,2-5,11H2,1H3,(H2,22,23,24,26) |
| InChIKey | XXFOSZPONMDEEK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |