C14H17N3O4 — CID 9413621
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate (PubChem CID 9413621) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 9413621 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] pyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H17N3O4/c18-12(17-14(20)16-11-5-1-2-6-11)9-21-13(19)10-4-3-7-15-8-10/h3-4,7-8,11H,1-2,5-6,9H2,(H2,16,17,18,20) |
| InChIKey | DGRASMMAEGRMAX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |