C23H25N3O6S — CID 6160338
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate (PubChem CID 6160338) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 6160338 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
| SMILES | O=C(COC(=O)c1cccc(NS(=O)(=O)/C=C/c2ccccc2)c1)NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C23H25N3O6S/c27-21(25-23(29)24-19-10-4-5-11-19)16-32-22(28)18-9-6-12-20(15-18)26-33(30,31)14-13-17-7-2-1-3-8-17/h1-3,6-9,12-15,19,26H,4-5,10-11,16H2,(H2,24,25,27,29)/b14-13+ |
| InChIKey | JMMUJNIIYZDJPL-BUHFOSPRSA-N |
| XLogP | 3.02 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |