C17H21N3O5 — CID 41120693
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 41120693) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 41120693 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C17H21N3O5/c1-10-11(2)19-14-5-4-12(8-13(10)14)16(22)25-9-15(21)20-17(23)18-6-7-24-3/h4-5,8,19H,6-7,9H2,1-3H3,(H2,18,20,21,23) |
| InChIKey | QOAHKPIFYQMANY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|