methyl 2,3-dimethyl-1H-indole-5-carboxylate

C12H13NO2 — CID 11344717

IUPACmethyl 2,3-dimethyl-1H-indole-5-carboxylate
SMILESCOC(=O)c1ccc2[nH]c(C)c(C)c2c1
InChIInChI=1S/C12H13NO2/c1-7-8(2)13-11-5-4-9(6-10(7)11)12(14)15-3/h4-6,13H,1-3H3
InChIKeyNFVUZOSPLNRNFF-UHFFFAOYSA-N
MW203.24 g/mol
LogP2.57
Rot. Bonds1

About methyl 2,3-dimethyl-1H-indole-5-carboxylate

methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 11344717) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is methyl 2,3-dimethyl-1H-indole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2,3-dimethyl-1H-indole-5-carboxylate
PubChem CID11344717
Molecular FormulaC12H13NO2
Molecular Weight203.24 g/mol
Exact Mass203.09
IUPAC Namemethyl 2,3-dimethyl-1H-indole-5-carboxylate
SMILESCOC(=O)c1ccc2[nH]c(C)c(C)c2c1
InChIInChI=1S/C12H13NO2/c1-7-8(2)13-11-5-4-9(6-10(7)11)12(14)15-3/h4-6,13H,1-3H3
InChIKeyNFVUZOSPLNRNFF-UHFFFAOYSA-N
XLogP2.57
TPSA42.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 52.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze methyl 2,3-dimethyl-1H-indole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,3-dimethyl-1H-indole-5-carboxylate?
The IUPAC name of methyl 2,3-dimethyl-1H-indole-5-carboxylate (CID 11344717) is methyl 2,3-dimethyl-1H-indole-5-carboxylate.
What is the SMILES notation for methyl 2,3-dimethyl-1H-indole-5-carboxylate?
The canonical SMILES for methyl 2,3-dimethyl-1H-indole-5-carboxylate is COC(=O)c1ccc2[nH]c(C)c(C)c2c1.
What is the InChIKey of methyl 2,3-dimethyl-1H-indole-5-carboxylate?
The InChIKey is NFVUZOSPLNRNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-7-8(2)13-11-5-4-9(6-10(7)11)12(14)15-3/h4-6,13H,1-3H3.
What are the key properties of methyl 2,3-dimethyl-1H-indole-5-carboxylate?
methyl 2,3-dimethyl-1H-indole-5-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,3-dimethyl-1H-indole-5-carboxylate is sourced from PubChem (CID 11344717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).