C21H22N2O3 — CID 18288127
propan-2-yl 4-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]benzoate (PubChem CID 18288127) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is propan-2-yl 4-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]benzoate.
| Compound Name | propan-2-yl 4-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 18288127 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | propan-2-yl 4-[(2,3-dimethyl-1H-indole-5-carbonyl)amino]benzoate |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3ccc(C(=O)OC(C)C)cc3)cc2c1C |
| InChI | InChI=1S/C21H22N2O3/c1-12(2)26-21(25)15-5-8-17(9-6-15)23-20(24)16-7-10-19-18(11-16)13(3)14(4)22-19/h5-12,22H,1-4H3,(H,23,24) |
| InChIKey | LRWGAHRYXKEGKI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|