C16H22N2O2 — CID 115606615
N-(1-methoxy-2-methylpropan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 115606615) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(1-methoxy-2-methylpropan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(1-methoxy-2-methylpropan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 115606615 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(1-methoxy-2-methylpropan-2-yl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | COCC(C)(C)NC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C16H22N2O2/c1-10-11(2)17-14-7-6-12(8-13(10)14)15(19)18-16(3,4)9-20-5/h6-8,17H,9H2,1-5H3,(H,18,19) |
| InChIKey | AIYDNULDFDVSOT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|