C19H16ClF3N2O2 — CID 134027334
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 134027334) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 134027334 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3cc(Cl)ccc3OCC(F)(F)F)cc2c1C |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-10-11(2)24-15-5-3-12(7-14(10)15)18(26)25-16-8-13(20)4-6-17(16)27-9-19(21,22)23/h3-8,24H,9H2,1-2H3,(H,25,26) |
| InChIKey | BTAKDDGBPMJQPL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|