C17H15IN2O — CID 26581665
N-(2-iodophenyl)-2,3-dimethyl-1H-indole-5-carboxamide (PubChem CID 26581665) has the molecular formula C17H15IN2O and a molecular weight of 390.22 g/mol. Its IUPAC name is N-(2-iodophenyl)-2,3-dimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(2-iodophenyl)-2,3-dimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 26581665 |
| Molecular Formula | C17H15IN2O |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | N-(2-iodophenyl)-2,3-dimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)Nc3ccccc3I)cc2c1C |
| InChI | InChI=1S/C17H15IN2O/c1-10-11(2)19-15-8-7-12(9-13(10)15)17(21)20-16-6-4-3-5-14(16)18/h3-9,19H,1-2H3,(H,20,21) |
| InChIKey | ABYJCJCDBHYVQH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|