C15H16N4O — CID 115630320
2,3-dimethyl-N-(4-methyl-1H-pyrazol-5-yl)-1H-indole-5-carboxamide (PubChem CID 115630320) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2,3-dimethyl-N-(4-methyl-1H-pyrazol-5-yl)-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-(4-methyl-1H-pyrazol-5-yl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 115630320 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2,3-dimethyl-N-(4-methyl-1H-pyrazol-5-yl)-1H-indole-5-carboxamide |
| SMILES | Cc1cn[nH]c1NC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C15H16N4O/c1-8-7-16-19-14(8)18-15(20)11-4-5-13-12(6-11)9(2)10(3)17-13/h4-7,17H,1-3H3,(H2,16,18,19,20) |
| InChIKey | TZUHMTQIBBQVNF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|