C12H12ClN3O3S — CID 115629937
4-chloro-N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide (PubChem CID 115629937) has the molecular formula C12H12ClN3O3S and a molecular weight of 313.77 g/mol. Its IUPAC name is 4-chloro-N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 115629937 |
| Molecular Formula | C12H12ClN3O3S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 4-chloro-N-(4-methyl-1H-pyrazol-5-yl)-3-methylsulfonylbenzamide |
| SMILES | Cc1cn[nH]c1NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H12ClN3O3S/c1-7-6-14-16-11(7)15-12(17)8-3-4-9(13)10(5-8)20(2,18)19/h3-6H,1-2H3,(H2,14,15,16,17) |
| InChIKey | IGGHZZOCGPAUFU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |