C8H9ClN2O3S — CID 43091103
4-chloro-3-methylsulfonylbenzohydrazide (PubChem CID 43091103) has the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. Its IUPAC name is 4-chloro-3-methylsulfonylbenzohydrazide.
| Compound Name | 4-chloro-3-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 43091103 |
| Molecular Formula | C8H9ClN2O3S |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 4-chloro-3-methylsulfonylbenzohydrazide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NN)ccc1Cl |
| InChI | InChI=1S/C8H9ClN2O3S/c1-15(13,14)7-4-5(8(12)11-10)2-3-6(7)9/h2-4H,10H2,1H3,(H,11,12) |
| InChIKey | BBNDHHWXOJBSIB-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|