C12H16ClNO4S — CID 115409695
4-chloro-N-(2-methylpropoxy)-3-methylsulfonylbenzamide (PubChem CID 115409695) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is 4-chloro-N-(2-methylpropoxy)-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(2-methylpropoxy)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 115409695 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-chloro-N-(2-methylpropoxy)-3-methylsulfonylbenzamide |
| SMILES | CC(C)CONC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H16ClNO4S/c1-8(2)7-18-14-12(15)9-4-5-10(13)11(6-9)19(3,16)17/h4-6,8H,7H2,1-3H3,(H,14,15) |
| InChIKey | YMAXKAZXZLNOND-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|