C11H12ClF2NO4S — CID 103769758
4-chloro-N-(3,3-difluoro-2-hydroxypropyl)-3-methylsulfonylbenzamide (PubChem CID 103769758) has the molecular formula C11H12ClF2NO4S and a molecular weight of 327.74 g/mol. Its IUPAC name is 4-chloro-N-(3,3-difluoro-2-hydroxypropyl)-3-methylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(3,3-difluoro-2-hydroxypropyl)-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 103769758 |
| Molecular Formula | C11H12ClF2NO4S |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 4-chloro-N-(3,3-difluoro-2-hydroxypropyl)-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NCC(O)C(F)F)ccc1Cl |
| InChI | InChI=1S/C11H12ClF2NO4S/c1-20(18,19)9-4-6(2-3-7(9)12)11(17)15-5-8(16)10(13)14/h2-4,8,10,16H,5H2,1H3,(H,15,17) |
| InChIKey | VUMBZBTUCUUDGC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |