C10H9ClF2INO2 — CID 103770165
3-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-iodobenzamide (PubChem CID 103770165) has the molecular formula C10H9ClF2INO2 and a molecular weight of 375.54 g/mol. Its IUPAC name is 3-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103770165 |
| Molecular Formula | C10H9ClF2INO2 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 3-chloro-N-(3,3-difluoro-2-hydroxypropyl)-4-iodobenzamide |
| SMILES | O=C(NCC(O)C(F)F)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClF2INO2/c11-6-3-5(1-2-7(6)14)10(17)15-4-8(16)9(12)13/h1-3,8-9,16H,4H2,(H,15,17) |
| InChIKey | PRTICFSFXCXIDW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|