C9H7ClF2INO — CID 103737133
3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide (PubChem CID 103737133) has the molecular formula C9H7ClF2INO and a molecular weight of 345.51 g/mol. Its IUPAC name is 3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide.
| Compound Name | 3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 103737133 |
| Molecular Formula | C9H7ClF2INO |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 3-chloro-N-(2,2-difluoroethyl)-4-iodobenzamide |
| SMILES | O=C(NCC(F)F)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C9H7ClF2INO/c10-6-3-5(1-2-7(6)13)9(15)14-4-8(11)12/h1-3,8H,4H2,(H,14,15) |
| InChIKey | FWTGVLSAJQGXPQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|