C15H11ClF2INO — CID 103222067
3-chloro-N-[2-(3,5-difluorophenyl)ethyl]-4-iodobenzamide (PubChem CID 103222067) has the molecular formula C15H11ClF2INO and a molecular weight of 421.61 g/mol. Its IUPAC name is 3-chloro-N-[2-(3,5-difluorophenyl)ethyl]-4-iodobenzamide.
| Compound Name | 3-chloro-N-[2-(3,5-difluorophenyl)ethyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 103222067 |
| Molecular Formula | C15H11ClF2INO |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 420.95 |
| IUPAC Name | 3-chloro-N-[2-(3,5-difluorophenyl)ethyl]-4-iodobenzamide |
| SMILES | O=C(NCCc1cc(F)cc(F)c1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClF2INO/c16-13-7-10(1-2-14(13)19)15(21)20-4-3-9-5-11(17)8-12(18)6-9/h1-2,5-8H,3-4H2,(H,20,21) |
| InChIKey | FBJQKYIUEZBOFX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|