C13H12ClF2NO2 — CID 115408367
3-chloro-N-(2,2-difluoroethyl)-4-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 115408367) has the molecular formula C13H12ClF2NO2 and a molecular weight of 287.69 g/mol. Its IUPAC name is 3-chloro-N-(2,2-difluoroethyl)-4-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | 3-chloro-N-(2,2-difluoroethyl)-4-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 115408367 |
| Molecular Formula | C13H12ClF2NO2 |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-chloro-N-(2,2-difluoroethyl)-4-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | O=C(NCC(F)F)c1ccc(C#CCCO)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClF2NO2/c14-11-7-10(13(19)17-8-12(15)16)5-4-9(11)3-1-2-6-18/h4-5,7,12,18H,2,6,8H2,(H,17,19) |
| InChIKey | IYGIUTDOIJMBGV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|