C16H13ClN2O2 — CID 81288851
3-chloro-4-(4-hydroxybut-1-ynyl)-N-pyridin-3-ylbenzamide (PubChem CID 81288851) has the molecular formula C16H13ClN2O2 and a molecular weight of 300.75 g/mol. Its IUPAC name is 3-chloro-4-(4-hydroxybut-1-ynyl)-N-pyridin-3-ylbenzamide.
| Compound Name | 3-chloro-4-(4-hydroxybut-1-ynyl)-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 81288851 |
| Molecular Formula | C16H13ClN2O2 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 3-chloro-4-(4-hydroxybut-1-ynyl)-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1ccc(C#CCCO)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O2/c17-15-10-13(7-6-12(15)4-1-2-9-20)16(21)19-14-5-3-8-18-11-14/h3,5-8,10-11,20H,2,9H2,(H,19,21) |
| InChIKey | VUAPHWVZIOKYFP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|