C15H17ClN2O3 — CID 81291003
N-(2-acetamidoethyl)-3-chloro-4-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 81291003) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-3-chloro-4-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(2-acetamidoethyl)-3-chloro-4-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 81291003 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(2-acetamidoethyl)-3-chloro-4-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccc(C#CCCO)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-11(20)17-7-8-18-15(21)13-6-5-12(14(16)10-13)4-2-3-9-19/h5-6,10,19H,3,7-9H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | UNGQCGIQDDBEIT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|