C17H23ClN2O — CID 83145803
4-(3-aminoprop-1-ynyl)-3-chloro-N-(2,3,3-trimethylbutyl)benzamide (PubChem CID 83145803) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 4-(3-aminoprop-1-ynyl)-3-chloro-N-(2,3,3-trimethylbutyl)benzamide.
| Compound Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-(2,3,3-trimethylbutyl)benzamide |
|---|---|
| PubChem CID | 83145803 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 4-(3-aminoprop-1-ynyl)-3-chloro-N-(2,3,3-trimethylbutyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(C#CCN)c(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C17H23ClN2O/c1-12(17(2,3)4)11-20-16(21)14-8-7-13(6-5-9-19)15(18)10-14/h7-8,10,12H,9,11,19H2,1-4H3,(H,20,21) |
| InChIKey | KNAAUZHYBXUHDH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|