C17H24N2O — CID 81475696
3-(3-aminoprop-1-ynyl)-N-(2,3-dimethylbutyl)-4-methylbenzamide (PubChem CID 81475696) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(2,3-dimethylbutyl)-4-methylbenzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(2,3-dimethylbutyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 81475696 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(2,3-dimethylbutyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC(C)C(C)C)cc1C#CCN |
| InChI | InChI=1S/C17H24N2O/c1-12(2)14(4)11-19-17(20)16-8-7-13(3)15(10-16)6-5-9-18/h7-8,10,12,14H,9,11,18H2,1-4H3,(H,19,20) |
| InChIKey | XLYWLQPDCULCIK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|