C18H24N2O — CID 81460592
3-(3-aminoprop-1-ynyl)-N-(1-cyclopentylethyl)-4-methylbenzamide (PubChem CID 81460592) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-(3-aminoprop-1-ynyl)-N-(1-cyclopentylethyl)-4-methylbenzamide.
| Compound Name | 3-(3-aminoprop-1-ynyl)-N-(1-cyclopentylethyl)-4-methylbenzamide |
|---|---|
| PubChem CID | 81460592 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 3-(3-aminoprop-1-ynyl)-N-(1-cyclopentylethyl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(C)C2CCCC2)cc1C#CCN |
| InChI | InChI=1S/C18H24N2O/c1-13-9-10-17(12-16(13)8-5-11-19)18(21)20-14(2)15-6-3-4-7-15/h9-10,12,14-15H,3-4,6-7,11,19H2,1-2H3,(H,20,21) |
| InChIKey | BCEVEWBMGGXNCR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|