C15H18N2O3 — CID 81475690
ethyl 2-[[3-(3-aminoprop-1-ynyl)-4-methylbenzoyl]amino]acetate (PubChem CID 81475690) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is ethyl 2-[[3-(3-aminoprop-1-ynyl)-4-methylbenzoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-(3-aminoprop-1-ynyl)-4-methylbenzoyl]amino]acetate |
|---|---|
| PubChem CID | 81475690 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | ethyl 2-[[3-(3-aminoprop-1-ynyl)-4-methylbenzoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1ccc(C)c(C#CCN)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-3-20-14(18)10-17-15(19)13-7-6-11(2)12(9-13)5-4-8-16/h6-7,9H,3,8,10,16H2,1-2H3,(H,17,19) |
| InChIKey | CSACDKJMAUQXQC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|