C10H11ClINO2 — CID 103884729
3-chloro-N-[(2R)-2-hydroxypropyl]-4-iodobenzamide (PubChem CID 103884729) has the molecular formula C10H11ClINO2 and a molecular weight of 339.56 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-hydroxypropyl]-4-iodobenzamide.
| Compound Name | 3-chloro-N-[(2R)-2-hydroxypropyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 103884729 |
| Molecular Formula | C10H11ClINO2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 3-chloro-N-[(2R)-2-hydroxypropyl]-4-iodobenzamide |
| SMILES | C[C@@H](O)CNC(=O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClINO2/c1-6(14)5-13-10(15)7-2-3-9(12)8(11)4-7/h2-4,6,14H,5H2,1H3,(H,13,15)/t6-/m1/s1 |
| InChIKey | FRNKPFAICQOYMR-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|