C15H20ClNO5S — CID 4825679
methyl 2-[(4-chloro-3-methylsulfonylbenzoyl)amino]-4-methylpentanoate (PubChem CID 4825679) has the molecular formula C15H20ClNO5S and a molecular weight of 361.85 g/mol. Its IUPAC name is methyl 2-[(4-chloro-3-methylsulfonylbenzoyl)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(4-chloro-3-methylsulfonylbenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 4825679 |
| Molecular Formula | C15H20ClNO5S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 2-[(4-chloro-3-methylsulfonylbenzoyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H20ClNO5S/c1-9(2)7-12(15(19)22-3)17-14(18)10-5-6-11(16)13(8-10)23(4,20)21/h5-6,8-9,12H,7H2,1-4H3,(H,17,18) |
| InChIKey | GPJJPRMDGUDLRO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |