C14H18ClNO6S — CID 55312037
[2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-chloro-3-methylsulfonylbenzoate (PubChem CID 55312037) has the molecular formula C14H18ClNO6S and a molecular weight of 363.82 g/mol. Its IUPAC name is [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 55312037 |
| Molecular Formula | C14H18ClNO6S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | [2-(1-methoxypropan-2-ylamino)-2-oxoethyl] 4-chloro-3-methylsulfonylbenzoate |
| SMILES | COCC(C)NC(=O)COC(=O)c1ccc(Cl)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H18ClNO6S/c1-9(7-21-2)16-13(17)8-22-14(18)10-4-5-11(15)12(6-10)23(3,19)20/h4-6,9H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | BUMXZPUVLSFVNO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |