C11H13ClN2O5S — CID 7823641
[2-(methylamino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate (PubChem CID 7823641) has the molecular formula C11H13ClN2O5S and a molecular weight of 320.75 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7823641 |
| Molecular Formula | C11H13ClN2O5S |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-chloro-3-(methylsulfamoyl)benzoate |
| SMILES | CNC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C11H13ClN2O5S/c1-13-10(15)6-19-11(16)7-3-4-8(12)9(5-7)20(17,18)14-2/h3-5,14H,6H2,1-2H3,(H,13,15) |
| InChIKey | RHVBVGJAZIRNOW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |